C14H19NO4 — CID 107722292
(2,5-dihydroxyphenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone (PubChem CID 107722292) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2,5-dihydroxyphenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone.
| Compound Name | (2,5-dihydroxyphenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 107722292 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2,5-dihydroxyphenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(O)ccc1O)N1CCCCC1CCO |
| InChI | InChI=1S/C14H19NO4/c16-8-6-10-3-1-2-7-15(10)14(19)12-9-11(17)4-5-13(12)18/h4-5,9-10,16-18H,1-3,6-8H2 |
| InChIKey | VPIFXBNHFPVBSK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|