C14H16BrF2NO2 — CID 86814312
(2-bromo-4,5-difluorophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone (PubChem CID 86814312) has the molecular formula C14H16BrF2NO2 and a molecular weight of 348.19 g/mol. Its IUPAC name is (2-bromo-4,5-difluorophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone.
| Compound Name | (2-bromo-4,5-difluorophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86814312 |
| Molecular Formula | C14H16BrF2NO2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | (2-bromo-4,5-difluorophenyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Br)N1CCCCC1CCO |
| InChI | InChI=1S/C14H16BrF2NO2/c15-11-8-13(17)12(16)7-10(11)14(20)18-5-2-1-3-9(18)4-6-19/h7-9,19H,1-6H2 |
| InChIKey | QELVNIKEIDTJPM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|