C13H12I3NO3 — CID 81125455
(3S)-1-(2,3,5-triiodobenzoyl)piperidine-3-carboxylic acid (PubChem CID 81125455) has the molecular formula C13H12I3NO3 and a molecular weight of 610.96 g/mol. Its IUPAC name is (3S)-1-(2,3,5-triiodobenzoyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2,3,5-triiodobenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81125455 |
| Molecular Formula | C13H12I3NO3 |
| Molecular Weight | 610.96 g/mol |
| Exact Mass | 610.80 |
| IUPAC Name | (3S)-1-(2,3,5-triiodobenzoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2cc(I)cc(I)c2I)C1 |
| InChI | InChI=1S/C13H12I3NO3/c14-8-4-9(11(16)10(15)5-8)12(18)17-3-1-2-7(6-17)13(19)20/h4-5,7H,1-3,6H2,(H,19,20)/t7-/m0/s1 |
| InChIKey | XQTIGYMFSDZCPG-ZETCQYMHSA-N |
| XLogP | 3.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.96 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|