C13H14I3NO2 — CID 43403373
[3-(hydroxymethyl)piperidin-1-yl]-(2,3,5-triiodophenyl)methanone (PubChem CID 43403373) has the molecular formula C13H14I3NO2 and a molecular weight of 596.97 g/mol. Its IUPAC name is [3-(hydroxymethyl)piperidin-1-yl]-(2,3,5-triiodophenyl)methanone.
| Compound Name | [3-(hydroxymethyl)piperidin-1-yl]-(2,3,5-triiodophenyl)methanone |
|---|---|
| PubChem CID | 43403373 |
| Molecular Formula | C13H14I3NO2 |
| Molecular Weight | 596.97 g/mol |
| Exact Mass | 596.82 |
| IUPAC Name | [3-(hydroxymethyl)piperidin-1-yl]-(2,3,5-triiodophenyl)methanone |
| SMILES | O=C(c1cc(I)cc(I)c1I)N1CCCC(CO)C1 |
| InChI | InChI=1S/C13H14I3NO2/c14-9-4-10(12(16)11(15)5-9)13(19)17-3-1-2-8(6-17)7-18/h4-5,8,18H,1-3,6-7H2 |
| InChIKey | ZXOLYCODVJPMET-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.97 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|