C14H19IN2O2 — CID 107732049
(2-hydroxy-5-iodophenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 107732049) has the molecular formula C14H19IN2O2 and a molecular weight of 374.22 g/mol. Its IUPAC name is (2-hydroxy-5-iodophenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | (2-hydroxy-5-iodophenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 107732049 |
| Molecular Formula | C14H19IN2O2 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (2-hydroxy-5-iodophenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CNCC1CCCN(C(=O)c2cc(I)ccc2O)C1 |
| InChI | InChI=1S/C14H19IN2O2/c1-16-8-10-3-2-6-17(9-10)14(19)12-7-11(15)4-5-13(12)18/h4-5,7,10,16,18H,2-3,6,8-9H2,1H3 |
| InChIKey | WKDSVNWQOIAXRC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|