C15H18ClNO3 — CID 120514108
(3S)-1-(2-chloro-4,5-dimethylbenzoyl)piperidine-3-carboxylic acid (PubChem CID 120514108) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is (3S)-1-(2-chloro-4,5-dimethylbenzoyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2-chloro-4,5-dimethylbenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120514108 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (3S)-1-(2-chloro-4,5-dimethylbenzoyl)piperidine-3-carboxylic acid |
| SMILES | Cc1cc(Cl)c(C(=O)N2CCC[C@H](C(=O)O)C2)cc1C |
| InChI | InChI=1S/C15H18ClNO3/c1-9-6-12(13(16)7-10(9)2)14(18)17-5-3-4-11(8-17)15(19)20/h6-7,11H,3-5,8H2,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | AHQSOAMKWUUXQL-NSHDSACASA-N |
| XLogP | 2.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |