C13H15NO5 — CID 107721752
(3S)-1-(2,5-dihydroxybenzoyl)piperidine-3-carboxylic acid (PubChem CID 107721752) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is (3S)-1-(2,5-dihydroxybenzoyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2,5-dihydroxybenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107721752 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (3S)-1-(2,5-dihydroxybenzoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2cc(O)ccc2O)C1 |
| InChI | InChI=1S/C13H15NO5/c15-9-3-4-11(16)10(6-9)12(17)14-5-1-2-8(7-14)13(18)19/h3-4,6,8,15-16H,1-2,5,7H2,(H,18,19)/t8-/m0/s1 |
| InChIKey | DSLYMOTVHUDRKI-QMMMGPOBSA-N |
| XLogP | 1.03 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|