C15H19NO5 — CID 51885492
(3S)-1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid (PubChem CID 51885492) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is (3S)-1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 51885492 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (3S)-1-(2,5-dimethoxybenzoyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc(OC)c(C(=O)N2CCC[C@H](C(=O)O)C2)c1 |
| InChI | InChI=1S/C15H19NO5/c1-20-11-5-6-13(21-2)12(8-11)14(17)16-7-3-4-10(9-16)15(18)19/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | HZRHKFIZNORLGE-JTQLQIEISA-N |
| XLogP | 1.64 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |