C13H15NO5 — CID 107727974
1-(3,4-dihydroxybenzoyl)piperidine-3-carboxylic acid (PubChem CID 107727974) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 1-(3,4-dihydroxybenzoyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(3,4-dihydroxybenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107727974 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-(3,4-dihydroxybenzoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C13H15NO5/c15-10-4-3-8(6-11(10)16)12(17)14-5-1-2-9(7-14)13(18)19/h3-4,6,9,15-16H,1-2,5,7H2,(H,18,19) |
| InChIKey | OEVUKGOADFZCGL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|