C12H15NO4 — CID 107300644
(3,4-dihydroxyphenyl)-[(3S)-3-hydroxypiperidin-1-yl]methanone (PubChem CID 107300644) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-[(3S)-3-hydroxypiperidin-1-yl]methanone.
| Compound Name | (3,4-dihydroxyphenyl)-[(3S)-3-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 107300644 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (3,4-dihydroxyphenyl)-[(3S)-3-hydroxypiperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(O)c(O)c1)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C12H15NO4/c14-9-2-1-5-13(7-9)12(17)8-3-4-10(15)11(16)6-8/h3-4,6,9,14-16H,1-2,5,7H2/t9-/m0/s1 |
| InChIKey | NPMRGTWCSZTSFA-VIFPVBQESA-N |
| XLogP | 0.69 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|