C16H21N3O3S2 — CID 42647700
S-(piperidine-1-carbothioyl) 3-[2-(2-hydroxybenzoyl)hydrazinyl]propanethioate (PubChem CID 42647700) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is S-(piperidine-1-carbothioyl) 3-[2-(2-hydroxybenzoyl)hydrazinyl]propanethioate.
| Compound Name | S-(piperidine-1-carbothioyl) 3-[2-(2-hydroxybenzoyl)hydrazinyl]propanethioate |
|---|---|
| PubChem CID | 42647700 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | S-(piperidine-1-carbothioyl) 3-[2-(2-hydroxybenzoyl)hydrazinyl]propanethioate |
| SMILES | O=C(CCNNC(=O)c1ccccc1O)SC(=S)N1CCCCC1 |
| InChI | InChI=1S/C16H21N3O3S2/c20-13-7-3-2-6-12(13)15(22)18-17-9-8-14(21)24-16(23)19-10-4-1-5-11-19/h2-3,6-7,17,20H,1,4-5,8-11H2,(H,18,22) |
| InChIKey | NTTLWQUNBIZUKP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|