C17H16N4O6 — CID 21348404
1-N',3-N'-bis(2-hydroxybenzoyl)propanedihydrazide (PubChem CID 21348404) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is 1-N',3-N'-bis(2-hydroxybenzoyl)propanedihydrazide.
| Compound Name | 1-N',3-N'-bis(2-hydroxybenzoyl)propanedihydrazide |
|---|---|
| PubChem CID | 21348404 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-N',3-N'-bis(2-hydroxybenzoyl)propanedihydrazide |
| SMILES | O=C(CC(=O)NNC(=O)c1ccccc1O)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C17H16N4O6/c22-12-7-3-1-5-10(12)16(26)20-18-14(24)9-15(25)19-21-17(27)11-6-2-4-8-13(11)23/h1-8,22-23H,9H2,(H,18,24)(H,19,25)(H,20,26)(H,21,27) |
| InChIKey | PRAIMTYGRDUKOD-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|