C16H16N2O4 — CID 51219078
2-hydroxy-N'-[4-(methoxymethyl)benzoyl]benzohydrazide (PubChem CID 51219078) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-hydroxy-N'-[4-(methoxymethyl)benzoyl]benzohydrazide.
| Compound Name | 2-hydroxy-N'-[4-(methoxymethyl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 51219078 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-hydroxy-N'-[4-(methoxymethyl)benzoyl]benzohydrazide |
| SMILES | COCc1ccc(C(=O)NNC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C16H16N2O4/c1-22-10-11-6-8-12(9-7-11)15(20)17-18-16(21)13-4-2-3-5-14(13)19/h2-9,19H,10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | ODVZEEIGOOKJHL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|