C10H12N2O3 — CID 15893878
2-hydroxy-N'-propanoylbenzohydrazide (PubChem CID 15893878) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-hydroxy-N'-propanoylbenzohydrazide.
| Compound Name | 2-hydroxy-N'-propanoylbenzohydrazide |
|---|---|
| PubChem CID | 15893878 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-hydroxy-N'-propanoylbenzohydrazide |
| SMILES | CCC(=O)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C10H12N2O3/c1-2-9(14)11-12-10(15)7-5-3-4-6-8(7)13/h3-6,13H,2H2,1H3,(H,11,14)(H,12,15) |
| InChIKey | DXTBBELJZACUHY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|