C14H14N2O3S — CID 47123757
5-ethyl-N'-(2-hydroxybenzoyl)thiophene-2-carbohydrazide (PubChem CID 47123757) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 5-ethyl-N'-(2-hydroxybenzoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-N'-(2-hydroxybenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 47123757 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-ethyl-N'-(2-hydroxybenzoyl)thiophene-2-carbohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2ccccc2O)s1 |
| InChI | InChI=1S/C14H14N2O3S/c1-2-9-7-8-12(20-9)14(19)16-15-13(18)10-5-3-4-6-11(10)17/h3-8,17H,2H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | NCRHEDOCFHNNQV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|