C10H16N2OS — CID 104873084
N-[(2R)-1-aminopropan-2-yl]-5-ethylthiophene-2-carboxamide (PubChem CID 104873084) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is N-[(2R)-1-aminopropan-2-yl]-5-ethylthiophene-2-carboxamide.
| Compound Name | N-[(2R)-1-aminopropan-2-yl]-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 104873084 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-[(2R)-1-aminopropan-2-yl]-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)N[C@H](C)CN)s1 |
| InChI | InChI=1S/C10H16N2OS/c1-3-8-4-5-9(14-8)10(13)12-7(2)6-11/h4-5,7H,3,6,11H2,1-2H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | MKRNXSGQGSNTFE-SSDOTTSWSA-N |
| XLogP | 1.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |