C14H22ClNOS — CID 106355739
N-(1-chloro-4,4-dimethylpentan-3-yl)-5-ethylthiophene-2-carboxamide (PubChem CID 106355739) has the molecular formula C14H22ClNOS and a molecular weight of 287.86 g/mol. Its IUPAC name is N-(1-chloro-4,4-dimethylpentan-3-yl)-5-ethylthiophene-2-carboxamide.
| Compound Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 106355739 |
| Molecular Formula | C14H22ClNOS |
| Molecular Weight | 287.86 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(1-chloro-4,4-dimethylpentan-3-yl)-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NC(CCCl)C(C)(C)C)s1 |
| InChI | InChI=1S/C14H22ClNOS/c1-5-10-6-7-11(18-10)13(17)16-12(8-9-15)14(2,3)4/h6-7,12H,5,8-9H2,1-4H3,(H,16,17) |
| InChIKey | MYSSYZJDZMHHER-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.86 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|