C12H17BrClNO2 — CID 106355672
5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)furan-2-carboxamide (PubChem CID 106355672) has the molecular formula C12H17BrClNO2 and a molecular weight of 322.63 g/mol. Its IUPAC name is 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 106355672 |
| Molecular Formula | C12H17BrClNO2 |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)furan-2-carboxamide |
| SMILES | CC(C)(C)C(CCCl)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H17BrClNO2/c1-12(2,3)9(6-7-14)15-11(16)8-4-5-10(13)17-8/h4-5,9H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | QRTBAXWDUCQTJR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|