C9H12BrNO3 — CID 81049675
5-bromo-N-(4-hydroxybutan-2-yl)furan-2-carboxamide (PubChem CID 81049675) has the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. Its IUPAC name is 5-bromo-N-(4-hydroxybutan-2-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(4-hydroxybutan-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 81049675 |
| Molecular Formula | C9H12BrNO3 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 5-bromo-N-(4-hydroxybutan-2-yl)furan-2-carboxamide |
| SMILES | CC(CCO)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C9H12BrNO3/c1-6(4-5-12)11-9(13)7-2-3-8(10)14-7/h2-3,6,12H,4-5H2,1H3,(H,11,13) |
| InChIKey | HTKBQCWCDXEFMZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |