C11H16BrNO3 — CID 103750870
5-bromo-N-(1-hydroxy-4-methylpentan-3-yl)furan-2-carboxamide (PubChem CID 103750870) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 5-bromo-N-(1-hydroxy-4-methylpentan-3-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(1-hydroxy-4-methylpentan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 103750870 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-bromo-N-(1-hydroxy-4-methylpentan-3-yl)furan-2-carboxamide |
| SMILES | CC(C)C(CCO)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H16BrNO3/c1-7(2)8(5-6-14)13-11(15)9-3-4-10(12)16-9/h3-4,7-8,14H,5-6H2,1-2H3,(H,13,15) |
| InChIKey | PJSHBKBJBMBZSV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |