C13H20ClNOS — CID 107847091
N-(6-chlorohexyl)-5-ethylthiophene-2-carboxamide (PubChem CID 107847091) has the molecular formula C13H20ClNOS and a molecular weight of 273.83 g/mol. Its IUPAC name is N-(6-chlorohexyl)-5-ethylthiophene-2-carboxamide.
| Compound Name | N-(6-chlorohexyl)-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107847091 |
| Molecular Formula | C13H20ClNOS |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(6-chlorohexyl)-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NCCCCCCCl)s1 |
| InChI | InChI=1S/C13H20ClNOS/c1-2-11-7-8-12(17-11)13(16)15-10-6-4-3-5-9-14/h7-8H,2-6,9-10H2,1H3,(H,15,16) |
| InChIKey | ZEMHGXVQXSSMJD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|