C10H15N3O2S — CID 76952712
N-(3-amino-3-hydroxyiminopropyl)-5-ethylthiophene-2-carboxamide (PubChem CID 76952712) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-5-ethylthiophene-2-carboxamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 76952712 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NCCC(N)=NO)s1 |
| InChI | InChI=1S/C10H15N3O2S/c1-2-7-3-4-8(16-7)10(14)12-6-5-9(11)13-15/h3-4,15H,2,5-6H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | XJIWNJBMNBLDSO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|