C10H15NO2S — CID 83031120
5-ethyl-N-[(2R)-2-hydroxypropyl]thiophene-2-carboxamide (PubChem CID 83031120) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 5-ethyl-N-[(2R)-2-hydroxypropyl]thiophene-2-carboxamide.
| Compound Name | 5-ethyl-N-[(2R)-2-hydroxypropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 83031120 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 5-ethyl-N-[(2R)-2-hydroxypropyl]thiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NC[C@@H](C)O)s1 |
| InChI | InChI=1S/C10H15NO2S/c1-3-8-4-5-9(14-8)10(13)11-6-7(2)12/h4-5,7,12H,3,6H2,1-2H3,(H,11,13)/t7-/m1/s1 |
| InChIKey | BPUPPOIYSORMTR-SSDOTTSWSA-N |
| XLogP | 1.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |