C13H19NO3S — CID 43170039
6-[(5-ethylthiophene-2-carbonyl)amino]hexanoic acid (PubChem CID 43170039) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 6-[(5-ethylthiophene-2-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(5-ethylthiophene-2-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 43170039 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 6-[(5-ethylthiophene-2-carbonyl)amino]hexanoic acid |
| SMILES | CCc1ccc(C(=O)NCCCCCC(=O)O)s1 |
| InChI | InChI=1S/C13H19NO3S/c1-2-10-7-8-11(18-10)13(17)14-9-5-3-4-6-12(15)16/h7-8H,2-6,9H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | UVRGSAQYCVGULG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|