C14H21NO3S — CID 43408697
methyl 6-[(5-ethylthiophene-2-carbonyl)amino]hexanoate (PubChem CID 43408697) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is methyl 6-[(5-ethylthiophene-2-carbonyl)amino]hexanoate.
| Compound Name | methyl 6-[(5-ethylthiophene-2-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 43408697 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 6-[(5-ethylthiophene-2-carbonyl)amino]hexanoate |
| SMILES | CCc1ccc(C(=O)NCCCCCC(=O)OC)s1 |
| InChI | InChI=1S/C14H21NO3S/c1-3-11-8-9-12(19-11)14(17)15-10-6-4-5-7-13(16)18-2/h8-9H,3-7,10H2,1-2H3,(H,15,17) |
| InChIKey | GZNXCFMGORXKGG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|