C17H18N2O3 — CID 31950720
2-hydroxy-N'-[3-(4-methylphenyl)propanoyl]benzohydrazide (PubChem CID 31950720) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-hydroxy-N'-[3-(4-methylphenyl)propanoyl]benzohydrazide.
| Compound Name | 2-hydroxy-N'-[3-(4-methylphenyl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 31950720 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-hydroxy-N'-[3-(4-methylphenyl)propanoyl]benzohydrazide |
| SMILES | Cc1ccc(CCC(=O)NNC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-12-6-8-13(9-7-12)10-11-16(21)18-19-17(22)14-4-2-3-5-15(14)20/h2-9,20H,10-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | BYUHDVHDEQVNTL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|