C15H18N4O3 — CID 30124446
N'-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-2-hydroxybenzohydrazide (PubChem CID 30124446) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N'-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 30124446 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N'-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-2-hydroxybenzohydrazide |
| SMILES | Cc1cc(C)n(CCC(=O)NNC(=O)c2ccccc2O)n1 |
| InChI | InChI=1S/C15H18N4O3/c1-10-9-11(2)19(18-10)8-7-14(21)16-17-15(22)12-5-3-4-6-13(12)20/h3-6,9,20H,7-8H2,1-2H3,(H,16,21)(H,17,22) |
| InChIKey | JZWYRFHSORFEIA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|