C14H17N3O2 — CID 19553824
3-(3,5-dimethylpyrazol-1-yl)-N-(2-hydroxyphenyl)propanamide (PubChem CID 19553824) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-(2-hydroxyphenyl)propanamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 19553824 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(2-hydroxyphenyl)propanamide |
| SMILES | Cc1cc(C)n(CCC(=O)Nc2ccccc2O)n1 |
| InChI | InChI=1S/C14H17N3O2/c1-10-9-11(2)17(16-10)8-7-14(19)15-12-5-3-4-6-13(12)18/h3-6,9,18H,7-8H2,1-2H3,(H,15,19) |
| InChIKey | RSUVMMZKLVDNBK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|