C18H20N4O3 — CID 24607746
N'-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 24607746) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N'-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 24607746 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N'-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1cc(C)n(CCC(=O)NNC(=O)c2oc3ccccc3c2C)n1 |
| InChI | InChI=1S/C18H20N4O3/c1-11-10-12(2)22(21-11)9-8-16(23)19-20-18(24)17-13(3)14-6-4-5-7-15(14)25-17/h4-7,10H,8-9H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | MXLJQEUIWVMKFW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|