C20H14ClN3O4 — CID 24665378
5-(4-chlorophenyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)-1,2-oxazole-3-carbohydrazide (PubChem CID 24665378) has the molecular formula C20H14ClN3O4 and a molecular weight of 395.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-(4-chlorophenyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 24665378 |
| Molecular Formula | C20H14ClN3O4 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-(3-methyl-1-benzofuran-2-carbonyl)-1,2-oxazole-3-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cc(-c3ccc(Cl)cc3)on2)oc2ccccc12 |
| InChI | InChI=1S/C20H14ClN3O4/c1-11-14-4-2-3-5-16(14)27-18(11)20(26)23-22-19(25)15-10-17(28-24-15)12-6-8-13(21)9-7-12/h2-10H,1H3,(H,22,25)(H,23,26) |
| InChIKey | OSEOVHPIEVZPME-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|