C16H10Cl3NO2 — CID 108793598
3-methyl-N-(2,4,6-trichlorophenyl)-1-benzofuran-2-carboxamide (PubChem CID 108793598) has the molecular formula C16H10Cl3NO2 and a molecular weight of 354.62 g/mol. Its IUPAC name is 3-methyl-N-(2,4,6-trichlorophenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-(2,4,6-trichlorophenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 108793598 |
| Molecular Formula | C16H10Cl3NO2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 3-methyl-N-(2,4,6-trichlorophenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2c(Cl)cc(Cl)cc2Cl)oc2ccccc12 |
| InChI | InChI=1S/C16H10Cl3NO2/c1-8-10-4-2-3-5-13(10)22-15(8)16(21)20-14-11(18)6-9(17)7-12(14)19/h2-7H,1H3,(H,20,21) |
| InChIKey | UIRVGGDHWYSATI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |