C17H12NO4- — CID 7463653
2-[(3-methyl-1-benzofuran-2-carbonyl)amino]benzoate (PubChem CID 7463653) has the molecular formula C17H12NO4- and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[(3-methyl-1-benzofuran-2-carbonyl)amino]benzoate.
| Compound Name | 2-[(3-methyl-1-benzofuran-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 7463653 |
| Molecular Formula | C17H12NO4- |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[(3-methyl-1-benzofuran-2-carbonyl)amino]benzoate |
| SMILES | Cc1c(C(=O)Nc2ccccc2C(=O)[O-])oc2ccccc12 |
| InChI | InChI=1S/C17H13NO4/c1-10-11-6-3-5-9-14(11)22-15(10)16(19)18-13-8-4-2-7-12(13)17(20)21/h2-9H,1H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | CYUSSVGNTOTYNH-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |