C17H13N3O5 — CID 26813929
3-methyl-N'-(2-nitrobenzoyl)-1-benzofuran-2-carbohydrazide (PubChem CID 26813929) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is 3-methyl-N'-(2-nitrobenzoyl)-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-methyl-N'-(2-nitrobenzoyl)-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 26813929 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-methyl-N'-(2-nitrobenzoyl)-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])oc2ccccc12 |
| InChI | InChI=1S/C17H13N3O5/c1-10-11-6-3-5-9-14(11)25-15(10)17(22)19-18-16(21)12-7-2-4-8-13(12)20(23)24/h2-9H,1H3,(H,18,21)(H,19,22) |
| InChIKey | FHLGYFPXOAPPSG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|