C22H17N3O3S — CID 24628583
N'-(3-methyl-1-benzofuran-2-carbonyl)-2-phenylsulfanylpyridine-3-carbohydrazide (PubChem CID 24628583) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is N'-(3-methyl-1-benzofuran-2-carbonyl)-2-phenylsulfanylpyridine-3-carbohydrazide.
| Compound Name | N'-(3-methyl-1-benzofuran-2-carbonyl)-2-phenylsulfanylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 24628583 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N'-(3-methyl-1-benzofuran-2-carbonyl)-2-phenylsulfanylpyridine-3-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cccnc2Sc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C22H17N3O3S/c1-14-16-10-5-6-12-18(16)28-19(14)21(27)25-24-20(26)17-11-7-13-23-22(17)29-15-8-3-2-4-9-15/h2-13H,1H3,(H,24,26)(H,25,27) |
| InChIKey | RWXLJYKPFFDXKO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|