C25H20N4O3S2 — CID 35825658
N'-[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbenzoyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 35825658) has the molecular formula C25H20N4O3S2 and a molecular weight of 488.59 g/mol. Its IUPAC name is N'-[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbenzoyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbenzoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 35825658 |
| Molecular Formula | C25H20N4O3S2 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | N'-[2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylbenzoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1sc2ncnc(Sc3ccccc3C(=O)NNC(=O)c3oc4ccccc4c3C)c2c1C |
| InChI | InChI=1S/C25H20N4O3S2/c1-13-15(3)33-24-20(13)25(27-12-26-24)34-19-11-7-5-9-17(19)22(30)28-29-23(31)21-14(2)16-8-4-6-10-18(16)32-21/h4-12H,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | GFPIFKCDHHONND-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|