C17H12N4O4S — CID 46652781
N'-(3-methyl-1-benzofuran-2-carbonyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbohydrazide (PubChem CID 46652781) has the molecular formula C17H12N4O4S and a molecular weight of 368.37 g/mol. Its IUPAC name is N'-(3-methyl-1-benzofuran-2-carbonyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbohydrazide.
| Compound Name | N'-(3-methyl-1-benzofuran-2-carbonyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 46652781 |
| Molecular Formula | C17H12N4O4S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N'-(3-methyl-1-benzofuran-2-carbonyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cnc3sccn3c2=O)oc2ccccc12 |
| InChI | InChI=1S/C17H12N4O4S/c1-9-10-4-2-3-5-12(10)25-13(9)15(23)20-19-14(22)11-8-18-17-21(16(11)24)6-7-26-17/h2-8H,1H3,(H,19,22)(H,20,23) |
| InChIKey | ZGDZLTKNRPZZEX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|