C16H14N4O4 — CID 51166600
1-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-6-oxopyridazine-3-carbohydrazide (PubChem CID 51166600) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-6-oxopyridazine-3-carbohydrazide.
| Compound Name | 1-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-6-oxopyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 51166600 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-6-oxopyridazine-3-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(=O)n(C)n2)oc2ccccc12 |
| InChI | InChI=1S/C16H14N4O4/c1-9-10-5-3-4-6-12(10)24-14(9)16(23)18-17-15(22)11-7-8-13(21)20(2)19-11/h3-8H,1-2H3,(H,17,22)(H,18,23) |
| InChIKey | RQSOTMYXSQPARX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|