C14H13ClN4O4S — CID 55590636
N'-(5-chloro-1-methylimidazol-4-yl)sulfonyl-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 55590636) has the molecular formula C14H13ClN4O4S and a molecular weight of 368.80 g/mol. Its IUPAC name is N'-(5-chloro-1-methylimidazol-4-yl)sulfonyl-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-(5-chloro-1-methylimidazol-4-yl)sulfonyl-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 55590636 |
| Molecular Formula | C14H13ClN4O4S |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N'-(5-chloro-1-methylimidazol-4-yl)sulfonyl-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNS(=O)(=O)c2ncn(C)c2Cl)oc2ccccc12 |
| InChI | InChI=1S/C14H13ClN4O4S/c1-8-9-5-3-4-6-10(9)23-11(8)13(20)17-18-24(21,22)14-12(15)19(2)7-16-14/h3-7,18H,1-2H3,(H,17,20) |
| InChIKey | VDLNNMCCSRUUNL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|