C19H18ClN3O5S — CID 26873876
2-chloro-N,N-dimethyl-5-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 26873876) has the molecular formula C19H18ClN3O5S and a molecular weight of 435.89 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-5-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | 2-chloro-N,N-dimethyl-5-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26873876 |
| Molecular Formula | C19H18ClN3O5S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 2-chloro-N,N-dimethyl-5-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Cl)c(S(=O)(=O)N(C)C)c2)oc2ccccc12 |
| InChI | InChI=1S/C19H18ClN3O5S/c1-11-13-6-4-5-7-15(13)28-17(11)19(25)22-21-18(24)12-8-9-14(20)16(10-12)29(26,27)23(2)3/h4-10H,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | JDRDQWSYZLKWNF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|