C20H19N3O5S — CID 27685815
4-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 27685815) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 4-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 27685815 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-[[(3-methyl-1-benzofuran-2-carbonyl)amino]carbamoyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)NNC(=O)c2oc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C20H19N3O5S/c1-3-12-21-29(26,27)15-10-8-14(9-11-15)19(24)22-23-20(25)18-13(2)16-6-4-5-7-17(16)28-18/h3-11,21H,1,12H2,2H3,(H,22,24)(H,23,25) |
| InChIKey | UBJOHMGCWYKPJV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|