C24H20N2O5S — CID 55789468
N'-[3-(benzenesulfonylmethyl)benzoyl]-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 55789468) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is N'-[3-(benzenesulfonylmethyl)benzoyl]-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-[3-(benzenesulfonylmethyl)benzoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 55789468 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N'-[3-(benzenesulfonylmethyl)benzoyl]-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cccc(CS(=O)(=O)c3ccccc3)c2)oc2ccccc12 |
| InChI | InChI=1S/C24H20N2O5S/c1-16-20-12-5-6-13-21(20)31-22(16)24(28)26-25-23(27)18-9-7-8-17(14-18)15-32(29,30)19-10-3-2-4-11-19/h2-14H,15H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | NPUXXNVEEIXPRK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|