C24H21N3O4S — CID 46490610
3-(benzenesulfonylmethyl)-N'-[2-(1H-indol-3-yl)acetyl]benzohydrazide (PubChem CID 46490610) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N'-[2-(1H-indol-3-yl)acetyl]benzohydrazide.
| Compound Name | 3-(benzenesulfonylmethyl)-N'-[2-(1H-indol-3-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 46490610 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N'-[2-(1H-indol-3-yl)acetyl]benzohydrazide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)NNC(=O)c1cccc(CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H21N3O4S/c28-23(14-19-15-25-22-12-5-4-11-21(19)22)26-27-24(29)18-8-6-7-17(13-18)16-32(30,31)20-9-2-1-3-10-20/h1-13,15,25H,14,16H2,(H,26,28)(H,27,29) |
| InChIKey | AJQMQQARHAIMMC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|