C24H21FN4O4S — CID 31830269
3-fluoro-N-[3-[[[2-(1H-indol-3-yl)acetyl]amino]carbamoyl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 31830269) has the molecular formula C24H21FN4O4S and a molecular weight of 480.52 g/mol. Its IUPAC name is 3-fluoro-N-[3-[[[2-(1H-indol-3-yl)acetyl]amino]carbamoyl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-[3-[[[2-(1H-indol-3-yl)acetyl]amino]carbamoyl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 31830269 |
| Molecular Formula | C24H21FN4O4S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 3-fluoro-N-[3-[[[2-(1H-indol-3-yl)acetyl]amino]carbamoyl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)NNC(=O)Cc3c[nH]c4ccccc34)c2)cc1F |
| InChI | InChI=1S/C24H21FN4O4S/c1-15-9-10-19(13-21(15)25)34(32,33)29-18-6-4-5-16(11-18)24(31)28-27-23(30)12-17-14-26-22-8-3-2-7-20(17)22/h2-11,13-14,26,29H,12H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | DFCBMXUZXAYEKE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|