C25H26FN3O4S — CID 33033434
3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-[4-(3-methylbutanoylamino)phenyl]benzamide (PubChem CID 33033434) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-[4-(3-methylbutanoylamino)phenyl]benzamide.
| Compound Name | 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-[4-(3-methylbutanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 33033434 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-[4-(3-methylbutanoylamino)phenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3ccc(NC(=O)CC(C)C)cc3)c2)cc1F |
| InChI | InChI=1S/C25H26FN3O4S/c1-16(2)13-24(30)27-19-8-10-20(11-9-19)28-25(31)18-5-4-6-21(14-18)29-34(32,33)22-12-7-17(3)23(26)15-22/h4-12,14-16,29H,13H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | URRQAUGYVYFVDL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |