C22H19ClFN3O4S — CID 55980726
N-(5-acetamido-2-chlorophenyl)-3-[(3-fluoro-4-methylphenyl)sulfonylamino]benzamide (PubChem CID 55980726) has the molecular formula C22H19ClFN3O4S and a molecular weight of 475.93 g/mol. Its IUPAC name is N-(5-acetamido-2-chlorophenyl)-3-[(3-fluoro-4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(5-acetamido-2-chlorophenyl)-3-[(3-fluoro-4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 55980726 |
| Molecular Formula | C22H19ClFN3O4S |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | N-(5-acetamido-2-chlorophenyl)-3-[(3-fluoro-4-methylphenyl)sulfonylamino]benzamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(NC(=O)c2cccc(NS(=O)(=O)c3ccc(C)c(F)c3)c2)c1 |
| InChI | InChI=1S/C22H19ClFN3O4S/c1-13-6-8-18(12-20(13)24)32(30,31)27-17-5-3-4-15(10-17)22(29)26-21-11-16(25-14(2)28)7-9-19(21)23/h3-12,27H,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | LWXZHBBPOZCQFJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |