C21H16F4N2O4S — CID 134050501
3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-[2-(trifluoromethoxy)phenyl]benzamide (PubChem CID 134050501) has the molecular formula C21H16F4N2O4S and a molecular weight of 468.43 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-[2-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-[2-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 134050501 |
| Molecular Formula | C21H16F4N2O4S |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 3-[(3-fluoro-4-methylphenyl)sulfonylamino]-N-[2-(trifluoromethoxy)phenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3ccccc3OC(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C21H16F4N2O4S/c1-13-9-10-16(12-17(13)22)32(29,30)27-15-6-4-5-14(11-15)20(28)26-18-7-2-3-8-19(18)31-21(23,24)25/h2-12,27H,1H3,(H,26,28) |
| InChIKey | JJMCOUSLSJLGGS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |