C19H18N2O5S — CID 22109365
3-methyl-N'-[3-(methylsulfonylmethyl)benzoyl]-1-benzofuran-2-carbohydrazide (PubChem CID 22109365) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is 3-methyl-N'-[3-(methylsulfonylmethyl)benzoyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[3-(methylsulfonylmethyl)benzoyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 22109365 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-methyl-N'-[3-(methylsulfonylmethyl)benzoyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2cccc(CS(C)(=O)=O)c2)oc2ccccc12 |
| InChI | InChI=1S/C19H18N2O5S/c1-12-15-8-3-4-9-16(15)26-17(12)19(23)21-20-18(22)14-7-5-6-13(10-14)11-27(2,24)25/h3-10H,11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | WNGNONLSHKWZMU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|