C18H15FN2O5S — CID 34966522
5-fluoro-3-methyl-N'-(4-methylsulfonylbenzoyl)-1-benzofuran-2-carbohydrazide (PubChem CID 34966522) has the molecular formula C18H15FN2O5S and a molecular weight of 390.39 g/mol. Its IUPAC name is 5-fluoro-3-methyl-N'-(4-methylsulfonylbenzoyl)-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-fluoro-3-methyl-N'-(4-methylsulfonylbenzoyl)-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 34966522 |
| Molecular Formula | C18H15FN2O5S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 5-fluoro-3-methyl-N'-(4-methylsulfonylbenzoyl)-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(S(C)(=O)=O)cc2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C18H15FN2O5S/c1-10-14-9-12(19)5-8-15(14)26-16(10)18(23)21-20-17(22)11-3-6-13(7-4-11)27(2,24)25/h3-9H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | LIYMUBGYIXGBLS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|