C18H17FN2O4S — CID 9080530
5-fluoro-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 9080530) has the molecular formula C18H17FN2O4S and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-fluoro-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-fluoro-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9080530 |
| Molecular Formula | C18H17FN2O4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 5-fluoro-3-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C18H17FN2O4S/c1-11-15-10-13(19)4-7-16(15)25-17(11)18(22)21-9-8-12-2-5-14(6-3-12)26(20,23)24/h2-7,10H,8-9H2,1H3,(H,21,22)(H2,20,23,24) |
| InChIKey | BTFHJAQQVOCVEW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |