C12H10FNO5 — CID 60708400
2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]oxyacetic acid (PubChem CID 60708400) has the molecular formula C12H10FNO5 and a molecular weight of 267.21 g/mol. Its IUPAC name is 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 60708400 |
| Molecular Formula | C12H10FNO5 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]oxyacetic acid |
| SMILES | Cc1c(C(=O)NOCC(=O)O)oc2ccc(F)cc12 |
| InChI | InChI=1S/C12H10FNO5/c1-6-8-4-7(13)2-3-9(8)19-11(6)12(17)14-18-5-10(15)16/h2-4H,5H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | BNJSOZKGPZGQIK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|